WL-300778 structure
|
Common Name | WL-300778 | ||
|---|---|---|---|---|
| CAS Number | 802980-14-9 | Molecular Weight | 177.22628 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WL-300778inhibitors of Rho associated protein kinases (ROCK1 and 2); Pteridine Reductase 1 Inhibitors; |
| Name | WL-300778 |
|---|
| Molecular Formula | C8H7N3S |
|---|---|
| Molecular Weight | 177.22628 |
| InChIKey | FCAZOVFEMFOLGO-UHFFFAOYSA-N |
| SMILES | CCN(C(=O)c1ccc(S(=O)(=O)N(C)c2ccccc2)cc1)c1nc2c(C)cccc2s1 |