Tyrocidine Complex structure
|
Common Name | Tyrocidine Complex | ||
|---|---|---|---|---|
| CAS Number | 8011-61-8 | Molecular Weight | 1270.48000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C66H87N13O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tyrocidine ComplexTyrocidine complex is a mixture of cyclic decapeptides originally isolated from B. brevis. |
| Name | tyrocidine A |
|---|
| Molecular Formula | C66H87N13O13 |
|---|---|
| Molecular Weight | 1270.48000 |
| Exact Mass | 1269.65000 |
| PSA | 414.64000 |
| LogP | 4.61050 |
| InChIKey | GSXRBRIWJGAPDU-BBVRJQLQSA-N |
| SMILES | CC(C)CC1NC(=O)C(CCCN)NC(=O)C(C(C)C)NC(=O)C(Cc2ccc(O)cc2)NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(Cc2ccccc2)NC(=O)C(Cc2ccccc2)NC(=O)C2CCCN2C(=O)C(Cc2ccccc2)NC1=O |