1-(4-chloro-3-nitrophenyl)propan-1-one structure
|
Common Name | 1-(4-chloro-3-nitrophenyl)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 80093-43-2 | Molecular Weight | 213.61800 | |
| Density | 1.324g/cm3 | Boiling Point | 302.5ºC at 760 mmHg | |
| Molecular Formula | C9H8ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.7ºC | |
| Name | 1-(4-chloro-3-nitrophenyl)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.324g/cm3 |
|---|---|
| Boiling Point | 302.5ºC at 760 mmHg |
| Molecular Formula | C9H8ClNO3 |
| Molecular Weight | 213.61800 |
| Flash Point | 136.7ºC |
| Exact Mass | 213.01900 |
| PSA | 62.89000 |
| LogP | 3.36410 |
| Index of Refraction | 1.562 |
| InChIKey | OGEKZGZVHGKFGG-UHFFFAOYSA-N |
| SMILES | CCC(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
|
~74%
1-(4-chloro-3-n... CAS#:80093-43-2 |
| Literature: Wang, Xiao-Jun; Zhang, Li; Sun, Xiufeng; Xu, Yibo; Krishnamurthy, Dhileepkumar; Senanayake, Chris H. Organic Letters, 2005 , vol. 7, # 25 p. 5593 - 5595 |
|
~10%
1-(4-chloro-3-n... CAS#:80093-43-2 |
| Literature: Ates-Alagoz, Zeynep; Coleman, Natalia; Martin, Marlena; Wan, Aaron; Adejare, Adeboye Chemical Biology and Drug Design, 2012 , vol. 80, # 6 p. 853 - 861 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-Chlor-3-nitro-propiophenon |