4-phenoxy-2,6-di(propan-2-yl)aniline structure
|
Common Name | 4-phenoxy-2,6-di(propan-2-yl)aniline | ||
|---|---|---|---|---|
| CAS Number | 80058-85-1 | Molecular Weight | 269.38100 | |
| Density | 1.026g/cm3 | Boiling Point | 371ºC at 760 mmHg | |
| Molecular Formula | C18H23NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.5ºC | |
| Name | 4-phenoxy-2,6-di(propan-2-yl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.026g/cm3 |
|---|---|
| Boiling Point | 371ºC at 760 mmHg |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.38100 |
| Flash Point | 164.5ºC |
| Exact Mass | 269.17800 |
| PSA | 35.25000 |
| LogP | 5.88910 |
| Index of Refraction | 1.563 |
| InChIKey | WRBGLNGTYOVAJO-UHFFFAOYSA-N |
| SMILES | CC(C)c1cc(Oc2ccccc2)cc(C(C)C)c1N |
|
~99%
4-phenoxy-2,6-d... CAS#:80058-85-1 |
| Literature: Organic Process Research and Development, , vol. 12, # 3 p. 537 - 539 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,6-diisopropyl-4-phenoxyaniline |
| 4-PHENOXY-2,6-DIISOPROPYL ANILINE |