Allyl Sulfide structure
|
Common Name | Allyl Sulfide | ||
|---|---|---|---|---|
| CAS Number | 8000-78-0 | Molecular Weight | 114.209 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 141.5±9.0 °C at 760 mmHg | |
| Molecular Formula | W99 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 46.1±0.0 °C | |
| Symbol |
GHS02, GHS07 |
Signal Word | Warning | |
| Name | Garlic oil |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 141.5±9.0 °C at 760 mmHg |
| Molecular Formula | W99 |
| Molecular Weight | 114.209 |
| Flash Point | 46.1±0.0 °C |
| Exact Mass | 114.050323 |
| LogP | 2.60 |
| Vapour Pressure | 7.3±0.3 mmHg at 25°C |
| Index of Refraction | 1.478 |
| InChIKey | YHQUMZMLYHQYSW-UHFFFAOYSA-N |
| SMILES | C=CCSS(=O)CC=C.C=CCSSCCC.C=CCSSSCC=C |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H226-H302 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T |
| Risk Phrases | R10;R36/37/38 |
| Safety Phrases | S36/S37/S39 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| RTECS | LX3154800 |
|
Effects of organosulfur compounds from garlic oil on the antioxidation system in rat liver and red blood cells.
Food Chem. Toxicol. 39(6) , 563-9, (2001) The modulation of garlic oil (GO) and three allyl compounds, diallyl sulfide (DAS), diallyl disulfide (DADS) and diallyl trisulfide (DATS), on the antioxidation system in rat livers and red blood cell... |
| Bis(2-propenyl) Sulfide |
| 3-(prop-2-en-1-ylsulfanyl)prop-1-ene |
| diprop-2-en-1-yl sulfide |
| Garlic oil blend |
| 3-(Allylsulfanyl)prop-1-ene |
| 1-Propene, 3,3'-thiobis- |
| MFCD00008658 |
| Allyl Sulfide |
| 3-(Allylsulfanyl)-1-propene |
| 3,3'-Thiobis-1-propene |
| Allium sativum |
| 3,3'-thiobis(prop-1-ene) |
| Diallyl sulfide |