Lily aldehyde structure
|
Common Name | Lily aldehyde | ||
|---|---|---|---|---|
| CAS Number | 80-54-6 | Molecular Weight | 204.308 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 277.7±9.0 °C at 760 mmHg | |
| Molecular Formula | C14H20O | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 120.9±10.2 °C | |
| Symbol |
GHS07, GHS08, GHS09 |
Signal Word | Warning | |
| Name | 3-(4-(Tert-butyl)phenyl)-2-methylpropanal |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 277.7±9.0 °C at 760 mmHg |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.308 |
| Flash Point | 120.9±10.2 °C |
| Exact Mass | 204.151413 |
| PSA | 17.07000 |
| LogP | 4.07 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | SDQFDHOLCGWZPU-UHFFFAOYSA-N |
| SMILES | CC(C=O)Cc1ccc(C(C)(C)C)cc1 |
| Storage condition | 2-8°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H317-H361-H411 |
| Precautionary Statements | P201-P273-P280-P308 + P313-P333 + P313-P391 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn:Harmful |
| Risk Phrases | R22;R38;R51/53 |
| Safety Phrases | S60 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 2 |
| RTECS | MW4895000 |
| Hazard Class | 9.0 |
| HS Code | 2912291000 |
| Precursor 7 | |
|---|---|
| DownStream 2 | |
| HS Code | 2912291000 |
|---|---|
| Summary | 2912291000. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
|
Oestrogenic activity of benzyl salicylate, benzyl benzoate and butylphenylmethylpropional (Lilial) in MCF7 human breast cancer cells in vitro.
J. Appl. Toxicol. 29(5) , 422-34, (2009) Benzyl salicylate, benzyl benzoate and butylphenylmethylpropional (Lilial) are added to bodycare cosmetics used around the human breast. We report here that all three compounds possess oestrogenic act... |
|
|
Odorants selectively activate distinct G protein subtypes in olfactory cilia.
J. Biol. Chem. 273(27) , 16669-77, (1998) Chemoelectrical signal transduction in olfactory neurons appears to involve intracellular reaction cascades mediated by heterotrimeric GTP-binding proteins. In this study attempts were made to identif... |
|
|
Blocking adenylyl cyclase inhibits olfactory generator currents induced by "IP(3)-odors".
J. Neurophysiol. 84(1) , 575-80, (2000) Vertebrate olfactory receptor neurons (ORNs) transduce odor stimuli into electrical signals by means of an adenylyl cyclase/cAMP second messenger cascade, but it remains widely debated whether this cA... |
| UNII-T7540GJV69 |
| 3-(4-tert-butylphenyl)-2-methylpropanal |
| 2-Methyl-3-[4-(2-methyl-2-propanyl)phenyl]propanal |
| Benzenepropanal, 4-(1,1-dimethylethyl)-α-methyl- |
| EINECS 201-289-8 |
| Propionaldehyde, β-(4-tert-butylphenyl)-α-methyl- |
| MFCD00047655 |
| VHY1&1R DX1&1&1 |
| Lily aldehyde |
| Lilial |