3-Amino-4-hydroxy-N-methylbenzenesulfonamide structure
|
Common Name | 3-Amino-4-hydroxy-N-methylbenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 80-23-9 | Molecular Weight | 202.231 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 407.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C7H10N2O3S | Melting Point | 124°C | |
| MSDS | N/A | Flash Point | 199.9±31.5 °C | |
| Name | 3-Amino-4-Hydroxy-N-Methylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 407.0±55.0 °C at 760 mmHg |
| Melting Point | 124°C |
| Molecular Formula | C7H10N2O3S |
| Molecular Weight | 202.231 |
| Flash Point | 199.9±31.5 °C |
| Exact Mass | 202.041214 |
| PSA | 100.80000 |
| LogP | -0.58 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | NFNLMGYLSDEJKS-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)c1ccc(O)c(N)c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S36 |
| WGK Germany | 2 |
| RTECS | OK8400000 |
| HS Code | 2935009090 |
|
~72%
3-Amino-4-hydro... CAS#:80-23-9 |
| Literature: GLAXOSMITHKLINE LLC; KALLANDER, Lara, S.; LAWHORN, Brian, Griffin; PHILIP, Joanne; ZHAO, Yongdong Patent: WO2011/88027 A1, 2011 ; Location in patent: Page/Page column 60-61 ; |
|
~%
3-Amino-4-hydro... CAS#:80-23-9 |
| Literature: WO2011/88027 A1, ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Benzenesulfonamide, 3-amino-4-hydroxy-N-methyl- |
| 3-Amino-4-hydroxy-N-methylbenzenesulfonamide |
| EINECS 201-262-0 |
| MFCD00142123 |