Sohirnone B
Sohirnone B structure
|
Common Name | Sohirnone B | ||
|---|---|---|---|---|
| CAS Number | 79950-85-9 | Molecular Weight | 232.27500 | |
| Density | 1.14g/cm3 | Boiling Point | 425.7ºC at 760 mmHg | |
| Molecular Formula | C14H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.4ºC | |
Use of Sohirnone BSorbicillin, a sorbicillinoid analogue, acts as a potent anti-inflammation agent[1]. |
| Name | (2E,4E)-1-(2,4-dihydroxy-3,5-dimethylphenyl)hexa-2,4-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Description | Sorbicillin, a sorbicillinoid analogue, acts as a potent anti-inflammation agent[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 425.7ºC at 760 mmHg |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.27500 |
| Flash Point | 225.4ºC |
| Exact Mass | 232.11000 |
| PSA | 57.53000 |
| LogP | 3.02960 |
| Index of Refraction | 1.586 |
| InChIKey | RKKPUBAAIGFXOG-YTXTXJHMSA-N |
| SMILES | CC=CC=CC(=O)c1cc(C)c(O)c(C)c1O |
|
~%
Sohirnone B CAS#:79950-85-9 |
| Literature: Nicolaou; Vassilikogiannakis, Georgios; Simonsen, Klaus B.; Baran, Phil S.; Zhong, Yong-Li; Vidali, Veroniki P.; Pitsinos, Emmanuel N.; Couladouros, Elias A. Journal of the American Chemical Society, 2000 , vol. 122, # 13 p. 3071 - 3079 |
|
~%
Sohirnone B CAS#:79950-85-9 |
| Literature: Nicolaou; Vassilikogiannakis, Georgios; Simonsen, Klaus B.; Baran, Phil S.; Zhong, Yong-Li; Vidali, Veroniki P.; Pitsinos, Emmanuel N.; Couladouros, Elias A. Journal of the American Chemical Society, 2000 , vol. 122, # 13 p. 3071 - 3079 |
|
~%
Sohirnone B CAS#:79950-85-9 |
| Literature: McOmie; Tute Journal of the Chemical Society, 1958 , p. 3226 |
|
~%
Sohirnone B CAS#:79950-85-9 |
| Literature: Bigi, Franca; Casiraghi, Giovanni; Casnati, Giuseppe; Marchesi, Stefania; Sartori, Giovanni; Vignali, Carlo Tetrahedron, 1984 , vol. 40, # 20 p. 4081 - 4084 |
|
~%
Sohirnone B CAS#:79950-85-9 |
| Literature: Kuhn; Staab Chemische Berichte, 1954 , vol. 87, p. 262,264 |
|
~%
Sohirnone B CAS#:79950-85-9 |
| Literature: Kuhn; Staab Chemische Berichte, 1954 , vol. 87, p. 262,264 |
|
~%
Sohirnone B CAS#:79950-85-9 |
| Literature: Kuhn; Staab Chemische Berichte, 1954 , vol. 87, p. 262,264 |
| Precursor 7 | |
|---|---|
| DownStream 3 | |
CAS#:88924-67-8
CAS#:79950-82-6| sorbicillinol |
| 1-(2,4-Dihydroxy-3,5-dimethyl-phenyl)-hexadien-(2t,4t)-on-(1) |
| Sorbicillin |
| 1-(2,4-dihydroxy-3,5-dimethyl-phenyl)-hexa-2t,4t-dien-1-one |
| Osrbicilin |
| 1-(2,4-Dihydroxy-3,5-dimethyl-phenyl)-hexa-2t,4t-dien-1-on |