N6-Benzoyl-9-β-D-arabinofuranosyladenine structure
|
Common Name | N6-Benzoyl-9-β-D-arabinofuranosyladenine | ||
|---|---|---|---|---|
| CAS Number | 79896-97-2 | Molecular Weight | 371.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17N5O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N6-Benzoyl-9-β-D-arabinofuranosyladenineN6-Benzoyl-9-β-D-arabinofuranosyladenine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
| Name | 9-(β-D-arabinofuranosyl)-N6-benzoyladenine |
|---|---|
| Synonym | More Synonyms |
| Description | N6-Benzoyl-9-β-D-arabinofuranosyladenine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C17H17N5O5 |
|---|---|
| Molecular Weight | 371.35 |
| Exact Mass | 371.12300 |
| PSA | 142.62000 |
| InChIKey | NZDWTKFDAUOODA-MMPOEDRJSA-N |
| SMILES | O=C(Nc1ncnc2c1ncn2C1OC(CO)C(O)C1O)c1ccccc1 |
| Storage condition | 2-8℃ |
| N6 -Benzoyl-9-β-D-arabinofuranosyladenine |
| N-benzoylarabinosyladenine |
| N6-benzoyl-9-β-D-arabinofuranosyladenine |
| N6-benzoyl-9-β-D-arabinofuranosyladenine |
| N6-benzoylarabinoadenosine |
| 6-N-benzoyl-9-(β-D-arabinofuranosyl)adenine |