(1Z,5Z,9Z)-14-benzyl-12-hydroxy-4,6,15,15a-tetramethyl-8,11-dioxo-4,7,8,11,14,14a,15,15a,16a,16b-decahydro-3H-cyclotrideca[d]oxireno[2,3-f]isoindol-7-yl acetate structure
|
Common Name | (1Z,5Z,9Z)-14-benzyl-12-hydroxy-4,6,15,15a-tetramethyl-8,11-dioxo-4,7,8,11,14,14a,15,15a,16a,16b-decahydro-3H-cyclotrideca[d]oxireno[2,3-f]isoindol-7-yl acetate | ||
|---|---|---|---|---|
| CAS Number | 79648-72-9 | Molecular Weight | 531.63900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H37NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (1Z,5Z,9Z)-14-benzyl-12-hydroxy-4,6,15,15a-tetramethyl-8,11-dioxo-4,7,8,11,14,14a,15,15a,16a,16b-decahydro-3H-cyclotrideca[d]oxireno[2,3-f]isoindol-7-yl acetateCytochalasin K (Compounds 7) is a cytochalasin that inhibits wheat root elongation with an IC50 of 22.58 μM[1]. |
| Name | (1Z,5Z,9Z)-14-benzyl-12-hydroxy-4,6,15,15a-tetramethyl-8,11-dioxo-4,7,8,11,14,14a,15,15a,16a,16b-decahydro-3H-cyclotrideca[d]oxireno[2,3-f]isoindol-7-yl acetate |
|---|
| Description | Cytochalasin K (Compounds 7) is a cytochalasin that inhibits wheat root elongation with an IC50 of 22.58 μM[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C32H37NO6 |
|---|---|
| Molecular Weight | 531.63900 |
| Exact Mass | 531.26200 |
| PSA | 105.56000 |
| LogP | 4.19780 |
| InChIKey | AZWOSJCABFILKS-XZRSCLCVSA-N |
| SMILES | CC(=O)OC1C(=O)C=CC(=O)C23C(=O)NC(Cc4ccccc4)C2C(C)C2(C)OC2C3C=CCC(C)C=C1C |