m-PEG7-Tos
Modify Date: 2025-08-25 13:07:17
m-PEG7-Tos structure
|
Common Name | m-PEG7-Tos | ||
|---|---|---|---|---|
| CAS Number | 79622-11-0 | Molecular Weight | 494.59600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H38O10S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of m-PEG7-Tosm-PEG7-Tos is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | mPEG7-OTs |
|---|---|
| Synonym | More Synonyms |
| Description | m-PEG7-Tos is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C22H38O10S |
|---|---|
| Molecular Weight | 494.59600 |
| Exact Mass | 494.21900 |
| PSA | 116.36000 |
| LogP | 2.52710 |
| InChIKey | ZTSLDMCZJSLHRN-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOS(=O)(=O)c1ccc(C)cc1 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:208987-04-6
CAS#:170572-38-0| MFCD21363273 |