Mefox structure
|
Common Name | Mefox | ||
|---|---|---|---|---|
| CAS Number | 79573-48-1 | Molecular Weight | 473.44 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H23N7O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MefoxMefox is a degradation product of folic acid (HY-16637)[1]. |
| Name | N-[4-[[(2-AMino-6,7,8,9-tetrahydro-8-Methyl-4,9-dioxo-4H-pyrazino[1,2-a]-1,3,5-triazin-7-yl)Methyl]aMino]benzoyl]-L-glutaMic Acid |
|---|
| Description | Mefox is a degradation product of folic acid (HY-16637)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C20H23N7O7 |
|---|---|
| Molecular Weight | 473.44 |
| InChIKey | AFIMZPFBSYESNQ-ABLWVSNPSA-N |
| SMILES | CN1C(=O)c2nc(N)nc(=O)n2CC1CNc1ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc1 |