4-azidophlorhizin
Modify Date: 2025-08-27 12:40:35
4-azidophlorhizin structure
|
Common Name | 4-azidophlorhizin | ||
|---|---|---|---|---|
| CAS Number | 79541-46-1 | Molecular Weight | 461.42202 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H23N3O9 | Melting Point | 168-170°C dec. | |
| MSDS | N/A | Flash Point | N/A | |
Use of 4-azidophlorhizin4-Azidophlorizin is a high affinity probe and photoaffinity label for the glucose transporter in brush border membranes[1]. |
| Name | 4-azidophlorhizin |
|---|
| Description | 4-Azidophlorizin is a high affinity probe and photoaffinity label for the glucose transporter in brush border membranes[1]. |
|---|---|
| Related Catalog | |
| References |
| Melting Point | 168-170°C dec. |
|---|---|
| Molecular Formula | C21H23N3O9 |
| Molecular Weight | 461.42202 |
| InChIKey | AXCDEMZKQHNYNE-QNDFHXLGSA-N |
| SMILES | [N-]=[N+]=Nc1ccc(CCC(=O)c2c(O)cc(O)cc2OC2OC(CO)C(O)C(O)C2O)cc1 |