1-benzyl d-aspartate structure
|
Common Name | 1-benzyl d-aspartate | ||
|---|---|---|---|---|
| CAS Number | 79337-40-9 | Molecular Weight | 223.22500 | |
| Density | 1.283g/cm3 | Boiling Point | 391ºC at 760 mmHg | |
| Molecular Formula | C11H13NO4 | Melting Point | 176ºC | |
| MSDS | N/A | Flash Point | 190.3ºC | |
Use of 1-benzyl d-aspartate1-Benzyl D-Aspartate is an aspartic acid derivative[1]. |
| Name | D-Aspartic Acid 1-Benzyl Ester |
|---|---|
| Synonym | More Synonyms |
| Description | 1-Benzyl D-Aspartate is an aspartic acid derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.283g/cm3 |
|---|---|
| Boiling Point | 391ºC at 760 mmHg |
| Melting Point | 176ºC |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.22500 |
| Flash Point | 190.3ºC |
| Exact Mass | 223.08400 |
| PSA | 89.62000 |
| LogP | 1.23210 |
| Index of Refraction | 14 ° (C=1, 0.1mol/L HCl) |
| InChIKey | NJSRYBIBUXBNSW-SECBINFHSA-N |
| SMILES | NC(CC(=O)O)C(=O)OCc1ccccc1 |
| HS Code | 2922509090 |
|---|
|
~99%
1-benzyl d-aspartate CAS#:79337-40-9 |
| Literature: Thaqi, Ali; McCluskey, Adam; Scott, Janet L. Tetrahedron Letters, 2008 , vol. 49, # 49 p. 6962 - 6964 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (3R)-3-amino-4-oxo-4-phenylmethoxybutanoate |