N-(benzhydrylideneamino)prop-2-enamide structure
|
Common Name | N-(benzhydrylideneamino)prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 79289-70-6 | Molecular Weight | 250.29500 | |
| Density | 1.04g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(benzhydrylideneamino)prop-2-enamide |
|---|
| Density | 1.04g/cm3 |
|---|---|
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.29500 |
| Exact Mass | 250.11100 |
| PSA | 41.46000 |
| LogP | 3.13210 |
| Index of Refraction | 1.565 |
| InChIKey | WDXXOLUPKCPJIT-UHFFFAOYSA-N |
| SMILES | C=CC(=O)NN=C(c1ccccc1)c1ccccc1 |
|
~0%
N-(benzhydrylid... CAS#:79289-70-6 |
| Literature: Taylor,E.C.; Haley,N.F.; Clemens,R.J. Journal of the American Chemical Society, 1981 , vol. 103, p. 7743 |
|
~%
N-(benzhydrylid... CAS#:79289-70-6 |
| Literature: Taylor,E.C.; Haley,N.F.; Clemens,R.J. Journal of the American Chemical Society, 1981 , vol. 103, p. 7743 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |