N-(benzhydrylideneamino)-3-chloro-2,2-dimethyl-propanamide structure
|
Common Name | N-(benzhydrylideneamino)-3-chloro-2,2-dimethyl-propanamide | ||
|---|---|---|---|---|
| CAS Number | 79289-24-0 | Molecular Weight | 314.80900 | |
| Density | 1.1g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H19ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(benzhydrylideneamino)-3-chloro-2,2-dimethylpropanamide |
|---|
| Density | 1.1g/cm3 |
|---|---|
| Molecular Formula | C18H19ClN2O |
| Molecular Weight | 314.80900 |
| Exact Mass | 314.11900 |
| PSA | 41.46000 |
| LogP | 4.21110 |
| Index of Refraction | 1.559 |
| InChIKey | GRBPLOVJEQBUSZ-UHFFFAOYSA-N |
| SMILES | CC(C)(CCl)C(=O)NN=C(c1ccccc1)c1ccccc1 |
|
~59%
N-(benzhydrylid... CAS#:79289-24-0 |
| Literature: Taylor,E.C.; Haley,N.F.; Clemens,R.J. Journal of the American Chemical Society, 1981 , vol. 103, p. 7743 |