tert-Butyl 4-(4-bromo-2-cyanophenyl)piperazine-1-carboxylate structure
|
Common Name | tert-Butyl 4-(4-bromo-2-cyanophenyl)piperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 791846-40-7 | Molecular Weight | 366.253 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 471.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H20BrN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.1±28.7 °C | |
| Name | tert-butyl 4-(4-bromo-2-cyanophenyl)piperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 471.7±45.0 °C at 760 mmHg |
| Molecular Formula | C16H20BrN3O2 |
| Molecular Weight | 366.253 |
| Flash Point | 239.1±28.7 °C |
| Exact Mass | 365.073883 |
| PSA | 56.57000 |
| LogP | 2.18 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.600 |
| InChIKey | LAYUEAVZGYNCJR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(Br)cc2C#N)CC1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933599090 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Piperazinecarboxylic acid, 4-(4-bromo-2-cyanophenyl)-, 1,1-dimethylethyl ester |
| tert-Butyl 4-(4-bromo-2-cyanophenyl)piperazine-1-carboxylate |
| 2-Methyl-2-propanyl 4-(4-bromo-2-cyanophenyl)-1-piperazinecarboxylate |