(4-nitrophenyl) 2-chloro-2-oxoacetate structure
|
Common Name | (4-nitrophenyl) 2-chloro-2-oxoacetate | ||
|---|---|---|---|---|
| CAS Number | 78974-67-1 | Molecular Weight | 229.57400 | |
| Density | 1.557g/cm3 | Boiling Point | 335.3ºC at 760 mmHg | |
| Molecular Formula | C8H4ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.6ºC | |
| Name | (4-nitrophenyl) 2-chloro-2-oxoacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.557g/cm3 |
|---|---|
| Boiling Point | 335.3ºC at 760 mmHg |
| Molecular Formula | C8H4ClNO5 |
| Molecular Weight | 229.57400 |
| Flash Point | 156.6ºC |
| Exact Mass | 228.97800 |
| PSA | 89.19000 |
| LogP | 1.78880 |
| Index of Refraction | 1.579 |
| InChIKey | ANLIRQCCCSNMMO-UHFFFAOYSA-N |
| SMILES | O=C(Cl)C(=O)Oc1ccc([N+](=O)[O-])cc1 |
|
~99%
(4-nitrophenyl)... CAS#:78974-67-1 |
| Literature: Timberlake, George T.; Reddy, G. Kesava; Stehno-Bittel, Lisa; Weber, Joerg F.; Amslinger, Sabine; Givens, Richard S. Photochemistry and Photobiology, 2002 , vol. 76, # 5 p. 473 - 479 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Aceticacid,chlorooxo-,4-nitrophenyl ester (9CI) |
| p-nitrobenzyl chlorooxalate |
| 4-Nitrophenyl chloro(oxo)acetate |
| Acetic acid,chlorooxo-,4-nitrophenyl ester |
| p-nitrophenyl oxalyl chloride |
| p-Nitrophenyl chloroglyoxylate |
| Acetic acid,2-chloro-2-oxo-,4-nitrophenyl ester |
| CHLOROOXOACETIC ACID 4-NITROPHENYL ESTER |