Ethanone,2-chloro-1-(4-nitrophenyl)- structure
|
Common Name | Ethanone,2-chloro-1-(4-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 34006-49-0 | Molecular Weight | 199.59100 | |
| Density | 1.384g/cm3 | Boiling Point | 322.1ºC at 760mmHg | |
| Molecular Formula | C8H6ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.6ºC | |
| Name | 2-chloro-1-(4-nitrophenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.384g/cm3 |
|---|---|
| Boiling Point | 322.1ºC at 760mmHg |
| Molecular Formula | C8H6ClNO3 |
| Molecular Weight | 199.59100 |
| Flash Point | 148.6ºC |
| Exact Mass | 199.00400 |
| PSA | 62.89000 |
| LogP | 2.53950 |
| Index of Refraction | 1.575 |
| InChIKey | YKLMHYUFNDAZAG-UHFFFAOYSA-N |
| SMILES | O=C(CCl)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2914700090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 8 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-nitrophenacyl chloride |
| 4-nitrophenyl chloromethyl ketone |
| 2-chloro-4'-nitroacetophenone |