Amorfrutin B
Modify Date: 2025-09-25 15:47:56
Amorfrutin B structure
|
Common Name | Amorfrutin B | ||
|---|---|---|---|---|
| CAS Number | 78916-42-4 | Molecular Weight | 408.530 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 550.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C26H32O4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 179.3±23.6 °C | |
| Name | Amorfrutin B |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 550.0±50.0 °C at 760 mmHg |
| Molecular Formula | C26H32O4 |
| Molecular Weight | 408.530 |
| Flash Point | 179.3±23.6 °C |
| Exact Mass | 408.230072 |
| LogP | 8.85 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | DKNIJLWIVUCTHW-CPNJWEJPSA-N |
| SMILES | COc1cc(CCc2ccccc2)c(C(=O)O)c(O)c1CC=C(C)CCC=C(C)C |
| RIDADR | NONH for all modes of transport |
|---|
|
Isolation and purification of prenylated phenolics from Amorpha fruticosa by high-speed counter-current chromatography.
J. Sep. Sci. 38(16) , 2924-9, (2015) Prenylated phenolics such as amorfrutins are recently identified potent anti-inflammatory and antidiabetic natural products. In this work, high-speed counter-current chromatography was investigated fo... |
|
|
Qualitative and quantitative analysis of amorfrutins, novel antidiabetic dietary natural products, by HPLC.
Pharm. Biol. , 1-6, (2015) Initially isolated from fruits of Amorpha fruticosa L. (Fabaceae), amorfrutins are promising antidiabetic natural products as selective peroxisome proliferator-activated receptor γ-agonists.The object... |
| 3-(3,7-dimethyloctyl)-2-hydroxy-4-methoxy-6-(2-phenylethyl)benzoic acid |
| Amorfrutin B |
| 3-[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]-2-hydroxy-4-methoxy-6-(2-phenylethyl)benzoic acid |
| Benzoic acid, 3-[(2E)-3,7-dimethyl-2,6-octadien-1-yl]-2-hydroxy-4-methoxy-6-(2-phenylethyl)- |