Ethanone,1-[4-[[(2-hydroxyphenyl)methylene]amino]phenyl]- structure
|
Common Name | Ethanone,1-[4-[[(2-hydroxyphenyl)methylene]amino]phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 788-23-8 | Molecular Weight | 239.26900 | |
| Density | 1.289g/cm3 | Boiling Point | 425.6ºC at 760 mmHg | |
| Molecular Formula | C15H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.2ºC | |
| Name | (6E)-6-[(4-acetylanilino)methylidene]cyclohexa-2,4-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.289g/cm3 |
|---|---|
| Boiling Point | 425.6ºC at 760 mmHg |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.26900 |
| Flash Point | 170.2ºC |
| Exact Mass | 239.09500 |
| PSA | 49.66000 |
| LogP | 3.34540 |
| Index of Refraction | 1.709 |
| InChIKey | NMHNMJLIXGLSFY-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(N=Cc2ccccc2O)cc1 |
|
~94%
Ethanone,1-[4-[... CAS#:788-23-8 |
| Literature: Thuy, Le Thi; Tien, Hoang Xuan; Hoang, Vu Dinh; Vu, Tran Khac Letters in Drug Design and Discovery, 2012 , vol. 9, # 2 p. 163 - 168 |
|
~86%
Ethanone,1-[4-[... CAS#:788-23-8 |
| Literature: De Lal; Banerjee; Mukherjee; Guha Indian Journal of Chemistry - Section A Inorganic, Physical, Theoretical and Analytical Chemistry, 2000 , vol. 39, # 10 p. 1050 - 1054 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Salicylidene p-aminoacetophenone |
| N-4-acetophenylsalicylaldimine |
| 4-Salicylamino-acetophenon |
| N-p-acetophenylsalicylaldimine |