oxalic acid,N-[(1S)-1-phenylethyl]hydroxylamine structure
|
Common Name | oxalic acid,N-[(1S)-1-phenylethyl]hydroxylamine | ||
|---|---|---|---|---|
| CAS Number | 78798-33-1 | Molecular Weight | 227.21400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13NO5 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
| Name | oxalic acid,N-[(1S)-1-phenylethyl]hydroxylamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H13NO5 |
|---|---|
| Molecular Weight | 227.21400 |
| Exact Mass | 227.07900 |
| PSA | 106.86000 |
| LogP | 1.27290 |
| InChIKey | GUXMGLCOBSBIKH-FJXQXJEOSA-N |
| SMILES | CC(NO)c1ccccc1.O=C(O)C(=O)O |
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H314 |
| Precautionary Statements | P280-P301 + P310-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| RIDADR | UN 3261 8 / PGIII |
| HS Code | 2928000090 |
|
~66%
oxalic acid,N-[... CAS#:78798-33-1 |
| Literature: PFIZER PRODUCTS INC. Patent: WO2008/4067 A2, 2008 ; Location in patent: Page/Page column 18 ; |
|
~%
oxalic acid,N-[... CAS#:78798-33-1 |
| Literature: Wovkulich; Uskokovic Tetrahedron, 1985 , vol. 41, # 17 p. 3455 - 3462 |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| (S)-N-(|A-Methylbenzyl)hydroxylamine oxalate salt |
| (|AR)-N-Hydroxy-|A-methyl-benzenemethanamine ethanedioate salt |
| N-hydroxy-(S)-1-phenylethylamine oxalate |
| (1S)-(1-phenylethyl)hydroxylamine oxalic acid salt |
| (S)-N-hydroxy-1-phenylethanamine oxalate |