(R)-(+)-N-(1-PHENYLETHYL)MALEIMIDE structure
|
Common Name | (R)-(+)-N-(1-PHENYLETHYL)MALEIMIDE | ||
|---|---|---|---|---|
| CAS Number | 78681-09-1 | Molecular Weight | 271.31100 | |
| Density | 1.212g/cm3 | Boiling Point | 557.1ºC at 760 mmHg | |
| Molecular Formula | C16H17NO3 | Melting Point | 157-159ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 290.7ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-[[(1R)-1-naphthalen-1-ylethyl]amino]-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.212g/cm3 |
|---|---|
| Boiling Point | 557.1ºC at 760 mmHg |
| Melting Point | 157-159ºC(lit.) |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.31100 |
| Flash Point | 290.7ºC |
| Exact Mass | 271.12100 |
| PSA | 66.40000 |
| LogP | 3.27270 |
| Index of Refraction | 1.608 |
| InChIKey | AUSXHLAOQYCBAR-LLVKDONJSA-N |
| SMILES | CC(NC(=O)CCC(=O)O)c1cccc2ccccc12 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2924299090 |
|
~55%
(R)-(+)-N-(1-PH... CAS#:78681-09-1 |
| Literature: Horner, Leopold; Klaus, Joachim Liebigs Annalen der Chemie, 1981 , # 5 p. 792 - 810 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Kozma, D. et al.
J. Therm. Anal. 44 , 339, (1995)
|
|
|
Acs, M. et al.
Chirality 6 , 314, (1994)
|
| MFCD00798364 |