(R)-2-Amino-1,1-diphenyl-1-propanol structure
|
Common Name | (R)-2-Amino-1,1-diphenyl-1-propanol | ||
|---|---|---|---|---|
| CAS Number | 78603-93-7 | Molecular Weight | 227.302 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 407.8±40.0 °C at 760 mmHg | |
| Molecular Formula | C15H17NO | Melting Point | 102-105 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 200.4±27.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (r)-2-amino-1,2-diphenyl-1-propanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 407.8±40.0 °C at 760 mmHg |
| Melting Point | 102-105 °C(lit.) |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.302 |
| Flash Point | 200.4±27.3 °C |
| Exact Mass | 227.131012 |
| PSA | 46.25000 |
| LogP | 2.72 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | FMBMNSFOFOAIMZ-GFCCVEGCSA-N |
| SMILES | CC(N)C(O)(c1ccccc1)c1ccccc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2922199090 |
|
~78%
(R)-2-Amino-1,1... CAS#:78603-93-7 |
| Literature: LONZA LTD; LONZA GUANGZHOU RESEARCH AND DEVELOPMENT CENTER LTD; DAI, Danmei; LONG, Xiangtian; LUO, Bing; KULESZA, Anna; REICHWAGEN, Jens; GUO, Yanming Patent: WO2012/97510 A1, 2012 ; Location in patent: Page/Page column 61 ; |
|
~%
(R)-2-Amino-1,1... CAS#:78603-93-7 |
| Literature: WO2010/148191 A2, ; Page/Page column 45-49; 64 ; |
|
~%
(R)-2-Amino-1,1... CAS#:78603-93-7 |
| Literature: Organic Process Research and Development, , vol. 11, # 3 p. 509 - 518 |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD07368633 |
| (2R)-2-amino-1,1-diphenylpropan-1-ol |
| Benzenemethanol, α-[(1R)-1-aminoethyl]-α-phenyl- |
| (2R)-2-Amino-1,1-diphenyl-1-propanol |
| R-2-amino-1,1-diphenylpropanol |