2,3-dichloronaphthalene-1,4,5,8-tetrone
Modify Date: 2025-08-26 15:04:56
2,3-dichloronaphthalene-1,4,5,8-tetrone structure
|
Common Name | 2,3-dichloronaphthalene-1,4,5,8-tetrone | ||
|---|---|---|---|---|
| CAS Number | 78456-63-0 | Molecular Weight | 257.02600 | |
| Density | 1.74g/cm3 | Boiling Point | 352.4ºC at 760 mmHg | |
| Molecular Formula | C10H2Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.8ºC | |
| Name | 2,3-dichloronaphthalene-1,4,5,8-tetrone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.74g/cm3 |
|---|---|
| Boiling Point | 352.4ºC at 760 mmHg |
| Molecular Formula | C10H2Cl2O4 |
| Molecular Weight | 257.02600 |
| Flash Point | 148.8ºC |
| Exact Mass | 255.93300 |
| PSA | 68.28000 |
| LogP | 0.03460 |
| Index of Refraction | 1.642 |
| InChIKey | JCGZOXQVXZJDSW-UHFFFAOYSA-N |
| SMILES | O=c1ccc(=O)c2c(=O)c(Cl)c(Cl)c(=O)c1=2 |
|
~85%
2,3-dichloronap... CAS#:78456-63-0 |
| Literature: Horowska; Mazerska; Ledochowski; Cristalli; Franchetti; Martelli European Journal of Medicinal Chemistry, 1988 , vol. 23, # 1 p. 91 - 96 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 2,3-Dichloronaphthodiquinone |
| 2,3-Dichloro-1,4,5,8-naphthalenetetrone |
| dichloronaphthodiquinone |
| 2,3-dichloro-1,4,5,8-naphthodiquinone |