4-Bromo-2-methyl-6-nitroaniline structure
|
Common Name | 4-Bromo-2-methyl-6-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 77811-44-0 | Molecular Weight | 231.047 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 326.8±37.0 °C at 760 mmHg | |
| Molecular Formula | C7H7BrN2O2 | Melting Point | 143-147 °C | |
| MSDS | Chinese USA | Flash Point | 151.4±26.5 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Bromo-2-methyl-6-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 326.8±37.0 °C at 760 mmHg |
| Melting Point | 143-147 °C |
| Molecular Formula | C7H7BrN2O2 |
| Molecular Weight | 231.047 |
| Flash Point | 151.4±26.5 °C |
| Exact Mass | 229.969086 |
| PSA | 71.84000 |
| LogP | 3.21 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | ZXFVKFUXKFPUQJ-UHFFFAOYSA-N |
| SMILES | Cc1cc(Br)cc([N+](=O)[O-])c1N |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H312-H315-H319-H332-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22 |
| Safety Phrases | S26-S36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2921430090 |
|
~99%
4-Bromo-2-methy... CAS#:77811-44-0 |
| Literature: LONZA LTD; BUeCHNER, Thomas; DRESSEL, Martina; HANSELMANN, Paul; KAISER, Rafael; KLEGRAF, Ellen; ZARAGOZA DOeRWALD, Florencio; DING, Zunliang; WONG, Heilam Patent: WO2010/81670 A2, 2010 ; Location in patent: Page/Page column 24 ; |
|
~35%
4-Bromo-2-methy... CAS#:77811-44-0 |
| Literature: Kyowa Hakko Kirin Co., Ltd. Patent: EP2327690 A1, 2011 ; Location in patent: Page/Page column 84 ; |
|
~%
4-Bromo-2-methy... CAS#:77811-44-0 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 192, p. 210 |
|
~%
4-Bromo-2-methy... CAS#:77811-44-0 |
| Literature: Chemische Berichte, , vol. 25, p. 864 |
|
~%
4-Bromo-2-methy... CAS#:77811-44-0 |
| Literature: Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, , vol. 19, # 12 p. 1035 - 1037 |
| Precursor 5 | |
|---|---|
| DownStream 10 | |
| HS Code | 2921430090 |
|---|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD00052919 |
| 4-bromo-2-methyl-6-nitro-aniline |
| 2-Amino-5-bromo-3-nitrotoluene,2-Amino-5-bromo-3-methylnitrobenzene,4-Bromo-6-nitro-o-toulidine |
| BenzenaMine,4-broMo-2-Methyl-6-nitro |
| 4-bromo-6-methyl-2-nitroaniline |
| 4-broMo-2-Methyl-6-nitroanilin |
| 4-Bromo-6-nitro-o-toluidine 2-Amino-5-bromo-3-nitrotoluene |
| Benzenamine, 4-bromo-2-methyl-6-nitro- |
| o-Nitro-p-brom-o-toluidin |
| 4-BROMO-6-NITRO-O-TOLUIDINE |
| 2-Nitro-4-bromo-6-methylaniline |
| 5-Brom-3-nitro-2-amino-toluol |
| 4-Brom-2-methyl-6-nitro-anilin |
| 4-BROMO-2-METHYL-6-NITRO-PHENYLAMINE |
| 4-Bromo-2-methyl-6-nitroaniline |
| 4-Bromo-2-methyl-6-nitrobenzenamine |