1,2-Dihydrotanshinquinone structure
|
Common Name | 1,2-Dihydrotanshinquinone | ||
|---|---|---|---|---|
| CAS Number | 77769-21-2 | Molecular Weight | 278.302 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 495.6±44.0 °C at 760 mmHg | |
| Molecular Formula | C18H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.6±21.1 °C | |
Use of 1,2-Dihydrotanshinquinone1,2-Dihydrotanshinone (1,2-Dihydrotanshinquinone) is an abietane diterpene. 1,2-Dihydrotanshinone inhibits the formation of the pathogenic complex formed between (CUG)n-RNA and the splicing-factor muscleblind-like 1 (MBNL1). 1,2-Dihydrotanshinone can be used for the research of myotonic dystrophy type 1[1][2]. |
| Name | 1,6-Dimethyl-8,9-dihydrophenanthro[1,2-b]furan-10,11-dione |
|---|---|
| Synonym | More Synonyms |
| Description | 1,2-Dihydrotanshinone (1,2-Dihydrotanshinquinone) is an abietane diterpene. 1,2-Dihydrotanshinone inhibits the formation of the pathogenic complex formed between (CUG)n-RNA and the splicing-factor muscleblind-like 1 (MBNL1). 1,2-Dihydrotanshinone can be used for the research of myotonic dystrophy type 1[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | 1,2-Dihydrotanshinone inhibits the formation of the pathogenic complex formed between (CUG)n-RNA and the splicing-factor muscleblind-like 1 (MBNL1) (≥50% inhibition at 100 µg/mL)[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 495.6±44.0 °C at 760 mmHg |
| Molecular Formula | C18H14O3 |
| Molecular Weight | 278.302 |
| Flash Point | 244.6±21.1 °C |
| Exact Mass | 278.094299 |
| LogP | 4.55 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | OYOSADAKNZWZGA-UHFFFAOYSA-N |
| SMILES | CC1=CCCc2c1ccc1c2C(=O)C(=O)c2c(C)coc2-1 |
| Phenanthro(1,2-b)furan-10,11-dione, 8,9-dihydro-1,6-dimethyl- |
| 1,6-Dimethyl-8,9-dihydrophenanthro[1,2-b]furan-10,11-dione |
| Phenanthro[1,2-b]furan-10,11-dione, 8,9-dihydro-1,6-dimethyl- |