3-(chlorosulfonyl)-4-hydroxybenzoic acid structure
|
Common Name | 3-(chlorosulfonyl)-4-hydroxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 77719-02-9 | Molecular Weight | 236.63000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H5ClO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-chlorosulfonyl-4-hydroxybenzoic acid |
|---|
| Molecular Formula | C7H5ClO5S |
|---|---|
| Molecular Weight | 236.63000 |
| Exact Mass | 235.95500 |
| PSA | 100.05000 |
| LogP | 2.09870 |
| InChIKey | UKNHBVJEQDQGIH-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(O)c(S(=O)(=O)Cl)c1 |
| HS Code | 2918290000 |
|---|
|
~59%
3-(chlorosulfon... CAS#:77719-02-9 |
| Literature: Cremlyn, Richard; Swinbourne, Frederick; Atherall, John; Courtney, Lynn; Cronje, Theo; at al. Phosphorus and Sulfur and the Related Elements, 1980 , vol. 9, p. 155 - 164 |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |