4-(2-Methoxy-phenyl)-2,4-dioxo-butyric acid
Modify Date: 2025-08-25 00:09:03
4-(2-Methoxy-phenyl)-2,4-dioxo-butyric acid structure
|
Common Name | 4-(2-Methoxy-phenyl)-2,4-dioxo-butyric acid | ||
|---|---|---|---|---|
| CAS Number | 77664-74-5 | Molecular Weight | 222.19400 | |
| Density | 1.309g/cm3 | Boiling Point | 393ºC at 760 mmHg | |
| Molecular Formula | C11H10O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.2ºC | |
| Name | 4-(2-methoxyphenyl)-2,4-dioxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.309g/cm3 |
|---|---|
| Boiling Point | 393ºC at 760 mmHg |
| Molecular Formula | C11H10O5 |
| Molecular Weight | 222.19400 |
| Flash Point | 155.2ºC |
| Exact Mass | 222.05300 |
| PSA | 80.67000 |
| LogP | 0.92170 |
| Index of Refraction | 1.546 |
| InChIKey | PZBLAHYFKVIGFG-UHFFFAOYSA-N |
| SMILES | COc1ccccc1C(=O)CC(=O)C(=O)O |
| HS Code | 2918990090 |
|---|
|
~%
4-(2-Methoxy-ph... CAS#:77664-74-5 |
| Literature: Ruah, Sara S. Hadida; Hazlewood, Anna R.; Grootenhuis, Peter D. J.; Singh, Ashvani Kumar; Cleveland, Thomas; Van-Goor, Frederick F. Patent: US2007/105833 A1, 2007 ; Location in patent: Page/Page column 49-50 ; |
|
~61%
4-(2-Methoxy-ph... CAS#:77664-74-5 |
| Literature: Cooke, Raymond G.; Merrett,Bryan K.; O'Loughlin, Gary J.; Pietersz, Geoffrey A. Australian Journal of Chemistry, 1980 , vol. 33, # 10 p. 2317 - 2324 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,4-dioxo-4-(2-methoxyphenyl)butanoic acid |
| 4-(2-Methoxy-phenyl)-2,4-dioxo-butyric acid |
| 2,4-dioxo-4-(2-methoxyphenyl)butyric acid |