Toddanone
Modify Date: 2025-08-27 18:03:19
Toddanone structure
|
Common Name | Toddanone | ||
|---|---|---|---|---|
| CAS Number | 77636-08-9 | Molecular Weight | 290.31100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ToddanoneToddanone, a coumarin, can be isolated from the root of Toddalia asiatica[1]. |
| Name | 2H-1-Benzopyran-2-one, 5,7-dimethoxy-6-(3-methyl-2-oxobutyl) |
|---|
| Description | Toddanone, a coumarin, can be isolated from the root of Toddalia asiatica[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C16H18O5 |
|---|---|
| Molecular Weight | 290.31100 |
| Exact Mass | 290.11500 |
| PSA | 65.74000 |
| LogP | 2.57780 |
| InChIKey | RUCHZOCSENTTRO-UHFFFAOYSA-N |
| SMILES | C=C(C)C(O)Cc1c(OC)cc2oc(=O)ccc2c1OC |