[2-Amino-4-(methoxycarbonyl)phenyl]boronic acid structure
|
Common Name | [2-Amino-4-(methoxycarbonyl)phenyl]boronic acid | ||
|---|---|---|---|---|
| CAS Number | 774530-27-7 | Molecular Weight | 194.98000 | |
| Density | 1.3±0.1g/cm3 | Boiling Point | 427.6±55.0°C at 760 mmHg | |
| Molecular Formula | C8H10BNO4 | Melting Point | 200-204°C | |
| MSDS | N/A | Flash Point | 212.4±31.5°C | |
| Name | (2-amino-4-methoxycarbonylphenyl)boronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1g/cm3 |
|---|---|
| Boiling Point | 427.6±55.0°C at 760 mmHg |
| Melting Point | 200-204°C |
| Molecular Formula | C8H10BNO4 |
| Molecular Weight | 194.98000 |
| Flash Point | 212.4±31.5°C |
| Exact Mass | 195.07000 |
| PSA | 92.78000 |
| Index of Refraction | 1.569 |
| InChIKey | OLHRJDVIFHDPLZ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(B(O)O)c(N)c1 |
| Hazard Codes | X |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26;S37;S60 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| [2-Amino-4-(methoxycarbonyl)phenyl]boronic acid |