1H-Benzimidazole,2-[(2-chloro-4-nitrophenyl)thio]- structure
|
Common Name | 1H-Benzimidazole,2-[(2-chloro-4-nitrophenyl)thio]- | ||
|---|---|---|---|---|
| CAS Number | 77436-85-2 | Molecular Weight | 305.74000 | |
| Density | 1.58g/cm3 | Boiling Point | 530.6ºC at 760mmHg | |
| Molecular Formula | C13H8ClN3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.7ºC | |
| Name | 2-(2-chloro-4-nitrophenyl)sulfanyl-1H-benzimidazole |
|---|
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 530.6ºC at 760mmHg |
| Molecular Formula | C13H8ClN3O2S |
| Molecular Weight | 305.74000 |
| Flash Point | 274.7ºC |
| Exact Mass | 305.00300 |
| PSA | 99.80000 |
| LogP | 4.79890 |
| Index of Refraction | 1.76 |
| InChIKey | SRXOFLCHVCMEAH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Sc2nc3ccccc3[nH]2)c(Cl)c1 |
|
~%
1H-Benzimidazol... CAS#:77436-85-2 |
| Literature: Rao, K. V. B.; Charles, E. S.; Sharma, Satyavan Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1981 , vol. 20, # 7 p. 575 - 578 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |