[6-Chloro-4-(2-chlorophenyl)-2-quinazolinyl]methanol
Modify Date: 2025-09-11 18:20:48
![[6-Chloro-4-(2-chlorophenyl)-2-quinazolinyl]methanol Structure](https://image.chemsrc.com/caspic/127/773871-49-1.png)
[6-Chloro-4-(2-chlorophenyl)-2-quinazolinyl]methanol structure
|
Common Name | [6-Chloro-4-(2-chlorophenyl)-2-quinazolinyl]methanol | ||
|---|---|---|---|---|
| CAS Number | 773871-49-1 | Molecular Weight | 305.159 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 384.4±42.0 °C at 760 mmHg | |
| Molecular Formula | C15H10Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.3±27.9 °C | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | [6-Chloro-4-(2-chlorophenyl)-2-quinazolinyl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 384.4±42.0 °C at 760 mmHg |
| Molecular Formula | C15H10Cl2N2O |
| Molecular Weight | 305.159 |
| Flash Point | 186.3±27.9 °C |
| Exact Mass | 304.017029 |
| LogP | 3.28 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.687 |
| InChIKey | FKDMILITBFQKKT-UHFFFAOYSA-N |
| SMILES | OCc1nc(-c2ccccc2Cl)c2cc(Cl)ccc2n1 |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H318-H413 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| [6-Chloro-4-(2-chlorophenyl)-2-quinazolinyl]methanol |
| 2-Quinazolinemethanol, 6-chloro-4-(2-chlorophenyl)- |
| 6-Chloro-4-(2-chlorophenyl)-2-quinazolinemethanol |