Colistin A sulfate hydrate
Modify Date: 2025-09-16 21:09:26
Colistin A sulfate hydrate structure
|
Common Name | Colistin A sulfate hydrate | ||
|---|---|---|---|---|
| CAS Number | 7722-44-3 | Molecular Weight | 1169.46000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C53H100N16O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Colistin A sulfate hydrateColistin A is a major component of Colistin. Colistin is a polymyxin antibiotic and can be used to combat infections caused by problematic gram-negative bacteria[1]. |
| Name | colistin A |
|---|
| Description | Colistin A is a major component of Colistin. Colistin is a polymyxin antibiotic and can be used to combat infections caused by problematic gram-negative bacteria[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C53H100N16O13 |
|---|---|
| Molecular Weight | 1169.46000 |
| Exact Mass | 1168.77000 |
| PSA | 490.66000 |
| LogP | 1.92530 |
| InChIKey | XDJYMJULXQKGMM-UHFFFAOYSA-N |
| SMILES | CCC(C)CCCCC(=O)NC(CCN)C(=O)NC(C(=O)NC(CCN)C(=O)NC1CCNC(=O)C(C(C)O)NC(=O)C(CCN)NC(=O)C(CCN)NC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)C(CCN)NC1=O)C(C)O |