3,3',4,4'-TETRABROMOBIPHENYL
Modify Date: 2025-08-25 22:46:13
3,3',4,4'-TETRABROMOBIPHENYL structure
|
Common Name | 3,3',4,4'-TETRABROMOBIPHENYL | ||
|---|---|---|---|---|
| CAS Number | 77102-82-0 | Molecular Weight | 469.79200 | |
| Density | 2.14 g/cm3 | Boiling Point | 430.9ºC at 760 mmHg | |
| Molecular Formula | C12H6Br4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.2ºC | |
| Name | 1,2-dibromo-4-(3,4-dibromophenyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.14 g/cm3 |
|---|---|
| Boiling Point | 430.9ºC at 760 mmHg |
| Molecular Formula | C12H6Br4 |
| Molecular Weight | 469.79200 |
| Flash Point | 207.2ºC |
| Exact Mass | 465.72000 |
| LogP | 6.40360 |
| Index of Refraction | 1.666 |
| InChIKey | BVGDXTYHVRFEQZ-UHFFFAOYSA-N |
| SMILES | Brc1ccc(-c2ccc(Br)c(Br)c2)cc1Br |
| HS Code | 2903999090 |
|---|
|
~%
3,3',4,4'-TETRA... CAS#:77102-82-0 |
| Literature: van Roosmalen Recueil des Travaux Chimiques des Pays-Bas, 1934 , vol. 53, p. 359,362 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3,4,3',4'-Tetrabrom-biphenyl |
| 3,3',4,4'-Tetrabromobiphenyl |
| 3,4,3',4'-tetrabromo-biphenyl |
| 1,1'-Biphenyl,3,3',4,4'-tetrabromo |