1-Phenyl-3-(4-phenyl-2-thiazolyl)guanidine structure
|
Common Name | 1-Phenyl-3-(4-phenyl-2-thiazolyl)guanidine | ||
|---|---|---|---|---|
| CAS Number | 7709-34-4 | Molecular Weight | 294.37400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)guanidine |
|---|
| Molecular Formula | C16H14N4S |
|---|---|
| Molecular Weight | 294.37400 |
| Exact Mass | 294.09400 |
| PSA | 89.04000 |
| LogP | 4.51460 |
| InChIKey | AQAKFENEXJKLOA-UHFFFAOYSA-N |
| SMILES | NC(=Nc1nc(-c2ccccc2)cs1)Nc1ccccc1 |
|
~%
1-Phenyl-3-(4-p... CAS#:7709-34-4 |
| Literature: American Cyanamid Company Patent: US4089965 A1, 1978 ; |
|
~%
1-Phenyl-3-(4-p... CAS#:7709-34-4 |
| Literature: Malik; Srivastava; Mehra Journal of medicinal chemistry, 1968 , vol. 11, # 6 p. 1268 - 1269 |
|
~%
1-Phenyl-3-(4-p... CAS#:7709-34-4 |
| Literature: Malik; Srivastava; Mehra Journal of medicinal chemistry, 1968 , vol. 11, # 6 p. 1268 - 1269 |
|
~%
1-Phenyl-3-(4-p... CAS#:7709-34-4 |
| Literature: Beyer,H.; Pommerening,K. Chemische Berichte, 1966 , vol. 99, p. 2937 - 2943 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |