bis[4-(oxolan-2-yl)butan-2-yl] nonanedioate structure
|
Common Name | bis[4-(oxolan-2-yl)butan-2-yl] nonanedioate | ||
|---|---|---|---|---|
| CAS Number | 7702-52-5 | Molecular Weight | 440.61300 | |
| Density | 1.028g/cm3 | Boiling Point | 514.4ºC at 760 mmHg | |
| Molecular Formula | C25H44O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.4ºC | |
| Name | bis[4-(oxolan-2-yl)butan-2-yl] nonanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.028g/cm3 |
|---|---|
| Boiling Point | 514.4ºC at 760 mmHg |
| Molecular Formula | C25H44O6 |
| Molecular Weight | 440.61300 |
| Flash Point | 216.4ºC |
| Exact Mass | 440.31400 |
| PSA | 71.06000 |
| LogP | 5.49890 |
| Index of Refraction | 1.473 |
| InChIKey | NCHOJZHFMFWTMB-UHFFFAOYSA-N |
| SMILES | CC(CCC1CCCO1)OC(=O)CCCCCCCC(=O)OC(C)CCC1CCCO1 |
|
~%
bis[4-(oxolan-2... CAS#:7702-52-5 |
| Literature: Russell et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 2161 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Azelainsaeure-bis-(1-methyl-3-tetrahydro[2]furyl-propylester) |
| azelaic acid bis-(1-methyl-3-tetrahydro[2]furyl-propyl ester) |