Decanoic acid,1-methyl-3-(tetrahydro-2-furanyl)propyl ester
Modify Date: 2025-08-25 19:32:06
Decanoic acid,1-methyl-3-(tetrahydro-2-furanyl)propyl ester structure
|
Common Name | Decanoic acid,1-methyl-3-(tetrahydro-2-furanyl)propyl ester | ||
|---|---|---|---|---|
| CAS Number | 7495-90-1 | Molecular Weight | 298.46100 | |
| Density | 0.934g/cm3 | Boiling Point | 374.7ºC at 760 mmHg | |
| Molecular Formula | C18H34O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.2ºC | |
| Name | 4-(oxolan-2-yl)butan-2-yl decanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.934g/cm3 |
|---|---|
| Boiling Point | 374.7ºC at 760 mmHg |
| Molecular Formula | C18H34O3 |
| Molecular Weight | 298.46100 |
| Flash Point | 145.2ºC |
| Exact Mass | 298.25100 |
| PSA | 35.53000 |
| LogP | 5.01800 |
| Index of Refraction | 1.455 |
| InChIKey | BDUYQLWQMKVMIG-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)OC(C)CCC1CCCO1 |
|
~%
Decanoic acid,1... CAS#:7495-90-1 |
| Literature: Russell et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 2161 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| decanoic acid-(1-methyl-3-tetrahydro[2]furyl-propyl ester) |
| Decansaeure-(1-methyl-3-tetrahydro[2]furyl-propylester) |