4-Bromo-2-nitrophenol structure
|
Common Name | 4-Bromo-2-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 7693-52-9 | Molecular Weight | 218.005 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 259.4±20.0 °C at 760 mmHg | |
| Molecular Formula | C6H4BrNO3 | Melting Point | 90-94 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 110.7±21.8 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Bromo-2-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 259.4±20.0 °C at 760 mmHg |
| Melting Point | 90-94 °C(lit.) |
| Molecular Formula | C6H4BrNO3 |
| Molecular Weight | 218.005 |
| Flash Point | 110.7±21.8 °C |
| Exact Mass | 216.937454 |
| PSA | 66.05000 |
| LogP | 2.52 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.652 |
| InChIKey | CUTFAPGINUFNQM-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Br)ccc1O |
| Water Solubility | Slightly soluble |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H332-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S36-S36/37/39 |
| RIDADR | 3077.0 |
| WGK Germany | 3 |
| RTECS | SJ8370000 |
| HS Code | 2908999090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
FXR agonist activity of conformationally constrained analogs of GW 4064.
Bioorg. Med. Chem. Lett. 19(16) , 4733-9, (2009) Two series of conformationally constrained analogs of the FXR agonist GW 4064 1 were prepared. Replacement of the metabolically labile stilbene with either benzothiophene or naphthalene rings led to t... |
| Phenol,2-nitro-5-bromo |
| 4-bromo-6-nitro-phenol |
| 4-Bromo-2-nitrophenol |
| 4-bromo-2-nitro-phenol |
| Phenol, 4-bromo-2-nitro- |
| 2-NO2 4-Br phenol |
| Phenol,4-bromo-2-nitro |
| MFCD00082540 |
| EINECS 231-707-4 |
| T-1,E-17(P) |
| Phenol, 2-nitro-5-bromo- |
| 4-Bromo-1-hydroxy-2-nitrobenzene |
| 2-nitro-4-bromo-phenol |