alpha-(2,4-Dichlorophenyl)-alpha-(4-fluorophenyl)-1H-1,2,4-triazole-1-ethanol structure
|
Common Name | alpha-(2,4-Dichlorophenyl)-alpha-(4-fluorophenyl)-1H-1,2,4-triazole-1-ethanol | ||
|---|---|---|---|---|
| CAS Number | 76674-22-1 | Molecular Weight | 352.19000 | |
| Density | 1.41g/cm3 | Boiling Point | 553.3ºC at 760 mmHg | |
| Molecular Formula | C16H12Cl2FN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.4ºC | |
| Name | 1-(2,4-dichlorophenyl)-1-(4-fluorophenyl)-2-(1,2,4-triazol-1-yl)ethanol |
|---|
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 553.3ºC at 760 mmHg |
| Molecular Formula | C16H12Cl2FN3O |
| Molecular Weight | 352.19000 |
| Flash Point | 288.4ºC |
| Exact Mass | 351.03400 |
| PSA | 50.94000 |
| LogP | 3.66010 |
| Index of Refraction | 1.634 |
| InChIKey | RBNYRMJSBJAEIA-UHFFFAOYSA-N |
| SMILES | OC(Cn1cncn1)(c1ccc(F)cc1)c1ccc(Cl)cc1Cl |
| HS Code | 2933990090 |
|---|
|
~39%
alpha-(2,4-Dich... CAS#:76674-22-1 |
| Literature: Shimizu, Sumio; Ogata, Masaru Synthetic Communications, 1989 , vol. 19, # 11-12 p. 2219 - 2228 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |