(2,4-dichlorophenyl)-(4-fluorophenyl)methanone structure
|
Common Name | (2,4-dichlorophenyl)-(4-fluorophenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 65214-59-7 | Molecular Weight | 269.09800 | |
| Density | 1.375g/cm3 | Boiling Point | 372.6ºC at 760 mmHg | |
| Molecular Formula | C13H7Cl2FO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.2ºC | |
| Name | 2,4-dichloro-4'-fluorobenzophenone |
|---|
| Density | 1.375g/cm3 |
|---|---|
| Boiling Point | 372.6ºC at 760 mmHg |
| Molecular Formula | C13H7Cl2FO |
| Molecular Weight | 269.09800 |
| Flash Point | 179.2ºC |
| Exact Mass | 267.98600 |
| PSA | 17.07000 |
| LogP | 4.36350 |
| Index of Refraction | 1.587 |
| InChIKey | UVAKGOJIHCGXID-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(F)cc1)c1ccc(Cl)cc1Cl |
| HS Code | 2914700090 |
|---|
|
~%
(2,4-dichloroph... CAS#:65214-59-7 |
| Literature: Janssen Pharmaceutica, N.V. Patent: US4200641 A1, 1980 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |