N-[(3,4-dichlorophenyl)carbamoyl]-N-methylformamide structure
|
Common Name | N-[(3,4-dichlorophenyl)carbamoyl]-N-methylformamide | ||
|---|---|---|---|---|
| CAS Number | 76409-92-2 | Molecular Weight | 247.07800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(3,4-dichlorophenyl)carbamoyl]-N-methylformamide |
|---|
| Molecular Formula | C9H8Cl2N2O2 |
|---|---|
| Molecular Weight | 247.07800 |
| Exact Mass | 245.99600 |
| PSA | 52.90000 |
| LogP | 3.26300 |
| InChIKey | ZMQCIZFNPLHWDZ-UHFFFAOYSA-N |
| SMILES | CN(C=O)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| HS Code | 2924299090 |
|---|
|
~%
N-[(3,4-dichlor... CAS#:76409-92-2 |
| Literature: Mazellier, Patrick; Sulzberger, Barbara Environmental Science and Technology, 2001 , vol. 35, # 16 p. 3314 - 3320 |
|
~%
N-[(3,4-dichlor... CAS#:76409-92-2 |
| Literature: Jirkovsky; Faure; Boule Pesticide Science, 1997 , vol. 50, # 1 p. 42 - 52 |
|
~%
Detail
|
| Literature: Mazellier; Jirkovsky; Bolte Pesticide Science, 1997 , vol. 49, # 3 p. 259 - 267 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |