1-(3-Chloro-4-hydroxyphenyl)-3,3-dimethylurea structure
|
Common Name | 1-(3-Chloro-4-hydroxyphenyl)-3,3-dimethylurea | ||
|---|---|---|---|---|
| CAS Number | 34637-13-3 | Molecular Weight | 214.64900 | |
| Density | 1.37g/cm3 | Boiling Point | 400.1ºC at 760 mmHg | |
| Molecular Formula | C9H11ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.8ºC | |
| Name | 3-(3-chloro-4-hydroxyphenyl)-1,1-dimethylurea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 400.1ºC at 760 mmHg |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.64900 |
| Flash Point | 195.8ºC |
| Exact Mass | 214.05100 |
| PSA | 56.06000 |
| LogP | 2.15270 |
| Index of Refraction | 1.628 |
| InChIKey | LCKMGLYSTXRASG-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)Nc1ccc(O)c(Cl)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(3-CHLORO-4-HYDROXYPHENYL)-N',N'-DIMETHYLUREA |
| 3-(3-chloro-4-hydroxy-phenyl)-1,1-dimethyl-urea |
| CHPDMU |
| N',N'-dimethyl-N-(3-chloro-4-hydroxyphenyl)urea |
| Hydroxymetoxuron |