3-HYDROXY-1-METHYL-3-(2-OXO-PROPYL)-1,3-DIHYDRO-INDOL-2-ONE
Modify Date: 2025-09-22 16:03:16
3-HYDROXY-1-METHYL-3-(2-OXO-PROPYL)-1,3-DIHYDRO-INDOL-2-ONE structure
|
Common Name | 3-HYDROXY-1-METHYL-3-(2-OXO-PROPYL)-1,3-DIHYDRO-INDOL-2-ONE | ||
|---|---|---|---|---|
| CAS Number | 76325-64-9 | Molecular Weight | 219.23700 | |
| Density | 1.269g/cm3 | Boiling Point | 476.8ºC at 760 mmHg | |
| Molecular Formula | C12H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.2ºC | |
| Name | 3-hydroxy-1-methyl-3-(2-oxopropyl)indol-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.269g/cm3 |
|---|---|
| Boiling Point | 476.8ºC at 760 mmHg |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.23700 |
| Flash Point | 242.2ºC |
| Exact Mass | 219.09000 |
| PSA | 57.61000 |
| LogP | 0.89470 |
| Index of Refraction | 1.582 |
| InChIKey | XAVUSUJIDHHQOA-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1(O)C(=O)N(C)c2ccccc21 |
| HS Code | 2933790090 |
|---|
|
~98%
3-HYDROXY-1-MET... CAS#:76325-64-9 |
| Literature: Malkov, Andrei V.; Kabeshov, Mikhail A.; Bella, Marco; Kysilka, Ondrej; Malyshev, Denis A.; Pluhackova, Kristyna; Kocovsky, Pavel Organic Letters, 2007 , vol. 9, # 26 p. 5473 - 5476 |
|
~77%
3-HYDROXY-1-MET... CAS#:76325-64-9 |
| Literature: Popp; Parson; Donigan Journal of Pharmaceutical Sciences, 1980 , vol. 69, # 10 p. 1235 - 1237 |
|
~95%
3-HYDROXY-1-MET... CAS#:76325-64-9 |
| Literature: Majumdar, Krishna C.; Kundu, Anup K.; Chatterjee, Pranab Journal of Chemical Research, Synopses, 1996 , # 10 p. 460 - 461 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933790090 |
|---|---|
| Summary | 2933790090. other lactams. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:9.0%. General tariff:20.0% |
| N-methyl-3-hydroxy-3-(2-oxopropyl)-2-oxindole |
| 3-hydroxy-1-methyl-3-(2'-oxopropyl)indolin-2-one |
| 3-Acetonyl-3-hydroxy-1-methyl-indolin-2-on |
| acetonyloxindole |
| 1-methyl-3-(2-oxopropyl)-3-hydroxyindol-2-one |
| 3-hydroxy-1-methyl-3-(2-oxopropyl)-1,3-dihydro-2H-indol-2-one |
| 3-acetonyl-3-hydroxy-1-methyl-indolin-2-one |