2-(iodomethyl)-7-[(4-methylphenyl)sulfonyloxymethyl]-3,5,8,10-tetraoxabicyclo[4.4.0]decane
Modify Date: 2025-09-15 11:28:33
![2-(iodomethyl)-7-[(4-methylphenyl)sulfonyloxymethyl]-3,5,8,10-tetraoxabicyclo[4.4.0]decane Structure](https://image.chemsrc.com/caspic/051/7622-00-6.png)
2-(iodomethyl)-7-[(4-methylphenyl)sulfonyloxymethyl]-3,5,8,10-tetraoxabicyclo[4.4.0]decane structure
|
Common Name | 2-(iodomethyl)-7-[(4-methylphenyl)sulfonyloxymethyl]-3,5,8,10-tetraoxabicyclo[4.4.0]decane | ||
|---|---|---|---|---|
| CAS Number | 7622-00-6 | Molecular Weight | 470.27700 | |
| Density | 1.608g/cm3 | Boiling Point | 553.6ºC at 760 mmHg | |
| Molecular Formula | C15H19IO7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.6ºC | |
| Name | [4-(iodomethyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-8-yl]methyl 4-methylbenzenesulfonate |
|---|
| Density | 1.608g/cm3 |
|---|---|
| Boiling Point | 553.6ºC at 760 mmHg |
| Molecular Formula | C15H19IO7S |
| Molecular Weight | 470.27700 |
| Flash Point | 288.6ºC |
| Exact Mass | 469.99000 |
| PSA | 88.67000 |
| LogP | 2.69910 |
| Index of Refraction | 1.561 |
| InChIKey | GNAYGCDTBNSBNU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCC2OCOC3C(CI)OCOC23)cc1 |
|
~%
2-(iodomethyl)-... CAS#:7622-00-6 |
| Literature: Ness et al. Journal of the American Chemical Society, 1944 , vol. 66, p. 1901,1904 |
|
~%
2-(iodomethyl)-... CAS#:7622-00-6 |
| Literature: Ness et al. Journal of the American Chemical Society, 1944 , vol. 66, p. 1901,1904 |
![2,7-bis[(4-methylphenyl)sulfonyloxymethyl]-3,5,8,10-tetraoxabicyclo[4.4.0]decane structure](https://image.chemsrc.com/caspic/225/7465-84-1.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |