N-diphenoxyphosphoryl-2-methyl-aniline
Modify Date: 2025-08-28 12:38:04
N-diphenoxyphosphoryl-2-methyl-aniline structure
|
Common Name | N-diphenoxyphosphoryl-2-methyl-aniline | ||
|---|---|---|---|---|
| CAS Number | 76168-00-8 | Molecular Weight | 339.32500 | |
| Density | 1.258g/cm3 | Boiling Point | 447.2ºC at 760 mmHg | |
| Molecular Formula | C19H18NO3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.3ºC | |
| Name | N-diphenoxyphosphoryl-2-methylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.258g/cm3 |
|---|---|
| Boiling Point | 447.2ºC at 760 mmHg |
| Molecular Formula | C19H18NO3P |
| Molecular Weight | 339.32500 |
| Flash Point | 224.3ºC |
| Exact Mass | 339.10200 |
| PSA | 57.37000 |
| LogP | 5.74600 |
| Index of Refraction | 1.625 |
| InChIKey | UJEPASNMYKNFKJ-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1NP(=O)(Oc1ccccc1)Oc1ccccc1 |
|
~%
N-diphenoxyphos... CAS#:76168-00-8 |
| Literature: Michaelis; Schulze Chemische Berichte, 1894 , vol. 27, p. 2573 |
|
~%
N-diphenoxyphos... CAS#:76168-00-8 |
| Literature: Bunyan,P.J.; Cadogan,J.I.G. Journal of the Chemical Society, 1962 , p. 1304 - 1308 |
|
~%
N-diphenoxyphos... CAS#:76168-00-8 |
| Literature: Michaelis; Schulze Chemische Berichte, 1894 , vol. 27, p. 2573 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| o-tolyl-amidophosphoric acid diphenyl ester |
| o-Tolylamido-phosphorsaeure-diphenylester |
| T0401-0312 |
| o-Toluidin-N-phosphinsaeure-diphenylester |
| Phosphorsaeure-diphenylester-o-toluidid |