6-[[3-[4-[3-[(6-oxo-1-cyclohexa-2,4-dienylidene)methylamino]propyl]piperazin-1-yl]propylamino]methylidene]cyclohexa-2,4-dien-1-one structure
|
Common Name | 6-[[3-[4-[3-[(6-oxo-1-cyclohexa-2,4-dienylidene)methylamino]propyl]piperazin-1-yl]propylamino]methylidene]cyclohexa-2,4-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 76094-07-0 | Molecular Weight | 408.53600 | |
| Density | 1.209g/cm3 | Boiling Point | 633.1ºC at 760 mmHg | |
| Molecular Formula | C24H32N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 336.7ºC | |
| Name | (6E)-6-[[3-[4-[3-[[(E)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]propyl]piperazin-1-yl]propylamino]methylidene]cyclohexa-2,4-dien-1-one |
|---|
| Density | 1.209g/cm3 |
|---|---|
| Boiling Point | 633.1ºC at 760 mmHg |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.53600 |
| Flash Point | 336.7ºC |
| Exact Mass | 408.25300 |
| PSA | 71.66000 |
| LogP | 2.90940 |
| Index of Refraction | 1.649 |
| InChIKey | AJDOIPXSGKUXJL-UHFFFAOYSA-N |
| SMILES | Oc1ccccc1C=NCCCN1CCN(CCCN=Cc2ccccc2O)CC1 |
|
~84%
6-[[3-[4-[3-[(6... CAS#:76094-07-0 |
| Literature: Keypour, Hassan; Rezaeivala, Majid; Dehghani-Firouzabadi, Ahmad A.M. Journal of Chemical Research, 2009 , # 2 p. 126 - 128 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |