1-methyl-4-(4-tert-butylphenoxy)sulfonyl-benzene structure
|
Common Name | 1-methyl-4-(4-tert-butylphenoxy)sulfonyl-benzene | ||
|---|---|---|---|---|
| CAS Number | 7598-28-9 | Molecular Weight | 304.40400 | |
| Density | 1.144g/cm3 | Boiling Point | 423ºC at 760mmHg | |
| Molecular Formula | C17H20O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.6ºC | |
| Name | (4-tert-butylphenyl) 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.144g/cm3 |
|---|---|
| Boiling Point | 423ºC at 760mmHg |
| Molecular Formula | C17H20O3S |
| Molecular Weight | 304.40400 |
| Flash Point | 209.6ºC |
| Exact Mass | 304.11300 |
| PSA | 51.75000 |
| LogP | 5.14100 |
| InChIKey | SUCZYFLKGVGAFM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(C(C)(C)C)cc2)cc1 |
|
~84%
1-methyl-4-(4-t... CAS#:7598-28-9 |
| Literature: Zim, Danilo; Lando, Vanusa R.; Dupont, Jairton; Monteiro, Adriano L. Organic Letters, 2001 , vol. 3, # 19 p. 3049 - 3051 |
|
~%
1-methyl-4-(4-t... CAS#:7598-28-9 |
| Literature: Huston; Hsieh Journal of the American Chemical Society, 1936 , vol. 58, p. 439 |
| Precursor 3 | |
|---|---|
| DownStream 7 | |
| 4-tert-butylphenyl p-toluenesulfonate |
| 4-tert-butylphenyl 4-tolylsulfonate |
| (4-tert-butylphenyl)4-methylbenzenesulfonate |
| 4-tert-butylphenyl tosylate |
| 4-t-butylphenyl tosylate |
| 4-t-butylphenyl 4-methylbenzenesulfonate |