diethylamino-2-butynylsuccinimide structure
|
Common Name | diethylamino-2-butynylsuccinimide | ||
|---|---|---|---|---|
| CAS Number | 7591-19-7 | Molecular Weight | 222.28400 | |
| Density | 1.084g/cm3 | Boiling Point | 384.3ºC at 760 mmHg | |
| Molecular Formula | C12H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.2ºC | |
| Name | 3-but-1-ynyl-3-(diethylamino)pyrrolidine-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.084g/cm3 |
|---|---|
| Boiling Point | 384.3ºC at 760 mmHg |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.28400 |
| Flash Point | 186.2ºC |
| Exact Mass | 222.13700 |
| PSA | 52.90000 |
| LogP | 0.80280 |
| Index of Refraction | 1.506 |
| InChIKey | YRECZPQEZNWZEK-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC#CCC1CC(=O)NC1=O |
|
~%
diethylamino-2-... CAS#:7591-19-7 |
| Literature: Ringdahl Journal of Medicinal Chemistry, 1988 , vol. 31, # 1 p. 164 - 168 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| dkj 21 |