2,2-dimethyl-6-oxo-8-phenyl-2H,6H-<1,2>thioxolo<4,5,1-hi>benzthioxole
Modify Date: 2025-09-18 15:15:27
2,2-dimethyl-6-oxo-8-phenyl-2H,6H-<1,2>thioxolo<4,5,1-hi>benzthioxole structure
|
Common Name | 2,2-dimethyl-6-oxo-8-phenyl-2H,6H-<1,2>thioxolo<4,5,1-hi>benzthioxole | ||
|---|---|---|---|---|
| CAS Number | 75893-92-4 | Molecular Weight | 286.34600 | |
| Density | 1.32g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H14O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2-dimethyl-6-oxo-8-phenyl-2H,6H-<1,2>thioxolo<4,5,1-hi>benzthioxole |
|---|
| Density | 1.32g/cm3 |
|---|---|
| Molecular Formula | C16H14O3S |
| Molecular Weight | 286.34600 |
| Exact Mass | 286.06600 |
| PSA | 60.83000 |
| LogP | 4.17490 |
| Index of Refraction | 1.641 |
| InChIKey | MZHUFQVDZQJNIV-UHFFFAOYSA-N |
| SMILES | CC1(C)OS2(c3ccccc3)OC(=O)c3cccc1c32 |
|
~83%
2,2-dimethyl-6-... CAS#:75893-92-4 |
| Literature: Lam, William Y.; Martin, J. C. Journal of the American Chemical Society, 1981 , vol. 103, # 1 p. 120 - 127 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
CAS#:75893-99-1